|
|
 |
| 4-Dimethylaminopyridine |
| Product name: |
4-Dimethylaminopyridine |
| Alias: |
4 dimethylamino pyridine; N,N-Dimethyl-4-pyridinamine; 4-(Dimethylamino)pyridine; p-Dimethylaminopyridine; gamma-(Dimethylamino)pyridine; 4-Dimethyl amino pyridine; 4-(dimethylamino)-pyridin; 4-Dimethylaminepyridine; N,N-Dimethyl-4-aminopyridine; n,n-dimethyl-4-pyridinamin; Pyridine, 4-(dimethylamino)-; AURORA KA-6495; 26DCLPY; 4-(Dimethylamino)pyridine, 99%, prilled; 4-(DIMETHYLAMINO)PYRIDINE SOLUTION; 4-(Dimethylamino)pyridine, ReagentPlus; N,N'-DIMEHTYL-4-PYRIDINAMINE; 4-(Dimethylamino) PyridineForSynthesis; 4-N,N-Dimethylaminopyridine; N,N-dimethylpyridin-4-amine; 4-dimethylamino pyridine; DMAP; N,N-dimethylpyridin-2-amine; 4-(dimethylamino)pyridinium; 4dimethylaminopyridine; 4-dimethylamiopryidine; Dimethyl-pyridin-4-yl-amine; Dimethyl-pyridin-4-yl-amine(DMAP); N-(4-Pyridyl)dimethylamine |
| CAS No.: |
1122-58-3 |
| EINECS No.: |
214-353-5 |
| Molecular formula: |
C7H10N2 |
| Molecular weight: |
122.1698 |
| InChI: |
InChI=1/C7H10N2/c1-9(2)7-3-5-8-6-4-7/h3-6H,1-2H3/p+1 |
| Molecular structure: |
 |
| Melting point: |
108-113℃ |
| Boiling point: |
194.9°C at 760 mmHg |
| Flash point: |
71.7°C |
| Water solubility: |
76 g/L (25℃) |
| Vapor pressure: |
0.431mmHg at 25°C |
| Physical and chemical properties: |
Properties light yellow or off-white Crystal |
| Uses: |
4 - Dimethylaminopyridine is a kind of widely used in chemical synthesis as a new type high efficiency catalyst, has high catalytic ability in organic synthesis, synthesis of drugs, pesticides, dyes, spices, such as synthesis of acylation and alkylation, etherification, and other types of the reaction, has the extremely obvious effect to improve yield. |
|
|
|
|
|
 |
|
