|
|
Triphenylphosphine |
Product name: |
Triphenylphosphine |
Alias: |
triphenyl phosphine; Triphenylphosphorus; triphenylphosphane hydrobromide (1:1); PPh3; triaryl phosphines; triarylphosphines; triphenyl phosphorous; trifenylfosfin; triphenylphosphane; triphenylphosphide; trifenylfosfin |
CAS No.: |
603-35-0 |
EINECS No.: |
210-036-0 |
Molecular formula: |
C18H15P |
Molecular weight: |
262.29 |
InChI: |
InChI=1/C18H15P.BrH/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h1-15H;1H |
Molecular structure: |
|
Melting point: |
78.5-81.5℃ |
Boiling point: |
360°C at 760 mmHg |
Flash point: |
181.7°C |
Water solubility: |
Insoluble |
Vapor pressure: |
4.74E-05mmHg at 25°C |
Physical and chemical properties: |
Density 1.132
Melting point 78.5-81.5°C
Boiling point 377°C
Flash point 181°C
Water solubility INSOLUBLE |
Uses: |
Used in organic synthesis, also used as a polymerization initiator, material of antimicrobial drugs such as chlorine lincomycin. |
|
|
|
|
|
|
|