|
|
 |
| Tri-n-butylphosphine |
| Product name: |
Tri-n-butylphosphine |
| Alias: |
TBUP; Tributylphosphinetech; Zukunft nur als S15-5801 Tri-n-butylphosphine; Trinbutylphosphinemincolorlesslightyellowliq; Trinbutylphosphineinhexane; Tributylphosphane; Tributyl phosphine |
| CAS No.: |
998-40-3 |
| EINECS No.: |
213-651-2 |
| Molecular formula: |
C12H27P |
| Molecular weight: |
202.3165 |
| InChI: |
InChI=1/C12H27P/c1-4-7-10-13(11-8-5-2)12-9-6-3/h4-12H2,1-3H3 |
| Molecular structure: |
 |
| Melting point: |
-65℃ |
| Boiling point: |
244.8°C at 760 mmHg |
| Flash point: |
112.2°C |
| Water solubility: |
insoluble |
| Vapor pressure: |
0.0466mmHg at 25°C |
| Physical and chemical properties: |
Density 0.812
Melting point -65°C
Boiling point 240-242°C
折射率 1.461-1.463
Flash point 40°C
Water solubility insoluble |
| Uses: |
Is the major ligand of homogeneous catalyst used in the production of petrochemical, can be used as a reducing agent, catalyst for olefin polymerization, etc. |
|
|
|
|
|
 |
|
