|
|
 |
| 2-Amino-5-bromopyridine |
| Product name: |
2-Amino-5-bromopyridine |
| Alias: |
5-Bromo-2-Pyridylamine; 5-Bromopyridin-2-Amine; 4-Amino-5-Chloro-2,1,3-Benzothiodiazole; 2-Amino-5-Bromo Pyridine; 2-amino-5-bromopyridinium |
| CAS No.: |
1072-97-5 |
| EINECS No.: |
214-019-9 |
| Molecular formula: |
C5H6BrN2 |
| Molecular weight: |
174.018 |
| InChI: |
InChI=1/C5H5BrN2/c6-4-1-2-5(7)8-3-4/h1-3H,(H2,7,8)/p+1 |
| Molecular structure: |
 |
| Melting point: |
135-138℃ |
| Boiling point: |
230.9°C at 760 mmHg |
| Flash point: |
93.4°C |
| Vapor pressure: |
0.0643mmHg at 25°C |
| Physical and chemical properties: |
Melting point 135-138°C |
| Uses: |
to produce drugs, and other fine chemicals. |
|
|
|
|
|
 |
|
